C17H19FN6OS — CID 55597205
1-(4-fluorophenyl)-5-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide (PubChem CID 55597205) has the molecular formula C17H19FN6OS and a molecular weight of 374.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55597205 |
| Molecular Formula | C17H19FN6OS |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2nnn(-c3ccc(F)cc3)c2C)s1 |
| InChI | InChI=1S/C17H19FN6OS/c1-3-4-5-6-14-20-22-17(26-14)19-16(25)15-11(2)24(23-21-15)13-9-7-12(18)8-10-13/h7-10H,3-6H2,1-2H3,(H,19,22,25) |
| InChIKey | HDWYJRRYBMRXDS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|