C24H28N6O2S2 — CID 16586931
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 16586931) has the molecular formula C24H28N6O2S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 16586931 |
| Molecular Formula | C24H28N6O2S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-(furan-2-ylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CC(Sc1nnc(N2CCCC2)n1Cc1ccco1)C(=O)Nc1sc2c(c1C#N)CCCCC2 |
| InChI | InChI=1S/C24H28N6O2S2/c1-16(21(31)26-22-19(14-25)18-9-3-2-4-10-20(18)34-22)33-24-28-27-23(29-11-5-6-12-29)30(24)15-17-8-7-13-32-17/h7-8,13,16H,2-6,9-12,15H2,1H3,(H,26,31) |
| InChIKey | KIKIUIYFUGGIFW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |