C23H25N5OS2 — CID 41189030
(2S)-2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)propanamide (PubChem CID 41189030) has the molecular formula C23H25N5OS2 and a molecular weight of 451.62 g/mol. Its IUPAC name is (2S)-2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)propanamide.
| Compound Name | (2S)-2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 41189030 |
| Molecular Formula | C23H25N5OS2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (2S)-2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)propanamide |
| SMILES | Cc1nnc(S[C@@H](C)C(=O)Nc2sc3c(c2C#N)CCCCC3)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H25N5OS2/c1-15(30-23-27-26-16(2)28(23)14-17-9-5-3-6-10-17)21(29)25-22-19(13-24)18-11-7-4-8-12-20(18)31-22/h3,5-6,9-10,15H,4,7-8,11-12,14H2,1-2H3,(H,25,29)/t15-/m0/s1 |
| InChIKey | XTBLPYOMSJQVKI-HNNXBMFYSA-N |
| XLogP | 4.96 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |