C25H30N6OS2 — CID 16512171
2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 16512171) has the molecular formula C25H30N6OS2 and a molecular weight of 494.69 g/mol. Its IUPAC name is 2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 16512171 |
| Molecular Formula | C25H30N6OS2 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | CCC(c1nnc(SCC(=O)Nc2sc3c(c2C#N)CCCC3)n1Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C25H30N6OS2/c1-4-20(30(2)3)23-28-29-25(31(23)15-17-10-6-5-7-11-17)33-16-22(32)27-24-19(14-26)18-12-8-9-13-21(18)34-24/h5-7,10-11,20H,4,8-9,12-13,15-16H2,1-3H3,(H,27,32) |
| InChIKey | IYMRHSYOOLRCOY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |