C19H17Cl2N5OS2 — CID 55422934
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propanamide (PubChem CID 55422934) has the molecular formula C19H17Cl2N5OS2 and a molecular weight of 466.42 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propanamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 55422934 |
| Molecular Formula | C19H17Cl2N5OS2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nnc2c(Cl)cc(Cl)cn12)C(=O)Nc1sc2c(c1C#N)CCCCC2 |
| InChI | InChI=1S/C19H17Cl2N5OS2/c1-10(28-19-25-24-16-14(21)7-11(20)9-26(16)19)17(27)23-18-13(8-22)12-5-3-2-4-6-15(12)29-18/h7,9-10H,2-6H2,1H3,(H,23,27) |
| InChIKey | RGBSIWTXJRPSGZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |