C25H27N3O3 — CID 16589219
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 16589219) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 16589219 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1oc(-c2ccccc2)nc1COC(=O)/C(C#N)=C/c1cc(C)n(CC(C)C)c1C |
| InChI | InChI=1S/C25H27N3O3/c1-16(2)14-28-17(3)11-21(18(28)4)12-22(13-26)25(29)30-15-23-19(5)31-24(27-23)20-9-7-6-8-10-20/h6-12,16H,14-15H2,1-5H3/b22-12+ |
| InChIKey | WPLRWMWUGFZMBY-WSDLNYQXSA-N |
| XLogP | 5.37 |
| TPSA | 81.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|