C18H13ClF3N3O2 — CID 16591096
1-(3-chloro-4-methylphenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-4,5-dihydropyridazine-3-carboxamide (PubChem CID 16591096) has the molecular formula C18H13ClF3N3O2 and a molecular weight of 395.77 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-methylphenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 16591096 |
| Molecular Formula | C18H13ClF3N3O2 |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
| SMILES | Cc1ccc(N2N=C(C(=O)Nc3ccc(F)c(F)c3F)CCC2=O)cc1Cl |
| InChI | InChI=1S/C18H13ClF3N3O2/c1-9-2-3-10(8-11(9)19)25-15(26)7-6-14(24-25)18(27)23-13-5-4-12(20)16(21)17(13)22/h2-5,8H,6-7H2,1H3,(H,23,27) |
| InChIKey | LEPDKAMVDLZYKC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|