C19H20N4O2S2 — CID 16592460
3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 16592460) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 16592460 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C=CCSc1nnc(NC(=O)CCc2ncc(-c3ccc(C)c(C)c3)o2)s1 |
| InChI | InChI=1S/C19H20N4O2S2/c1-4-9-26-19-23-22-18(27-19)21-16(24)7-8-17-20-11-15(25-17)14-6-5-12(2)13(3)10-14/h4-6,10-11H,1,7-9H2,2-3H3,(H,21,22,24) |
| InChIKey | OGQXCMMSZHSVME-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|