C22H26N6O2S — CID 16593977
N-[3-(N-methylanilino)propyl]-4-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide (PubChem CID 16593977) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-4-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-4-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16593977 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-4-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide |
| SMILES | CN(CCCNC(=O)c1ccc(NC(=O)CSc2nncn2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N6O2S/c1-27(19-7-4-3-5-8-19)14-6-13-23-21(30)17-9-11-18(12-10-17)25-20(29)15-31-22-26-24-16-28(22)2/h3-5,7-12,16H,6,13-15H2,1-2H3,(H,23,30)(H,25,29) |
| InChIKey | ZDCAKNAQVDKNAJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|