C17H23N5OS — CID 41269841
2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 41269841) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 41269841 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | CN(CCCNC(=O)CSc1nncn1C1CC1)c1ccccc1 |
| InChI | InChI=1S/C17H23N5OS/c1-21(14-6-3-2-4-7-14)11-5-10-18-16(23)12-24-17-20-19-13-22(17)15-8-9-15/h2-4,6-7,13,15H,5,8-12H2,1H3,(H,18,23) |
| InChIKey | SZLQUOVIUILLQT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|