C25H34N6OS — CID 34504974
2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 34504974) has the molecular formula C25H34N6OS and a molecular weight of 466.66 g/mol. Its IUPAC name is 2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 34504974 |
| Molecular Formula | C25H34N6OS |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | CCN(CC)c1ccc(-c2nnc(SCC(=O)NCCCN(C)c3ccccc3)n2C)cc1 |
| InChI | InChI=1S/C25H34N6OS/c1-5-31(6-2)22-15-13-20(14-16-22)24-27-28-25(30(24)4)33-19-23(32)26-17-10-18-29(3)21-11-8-7-9-12-21/h7-9,11-16H,5-6,10,17-19H2,1-4H3,(H,26,32) |
| InChIKey | AVNIOJNTVLLPHZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|