C23H26ClN5OS — CID 41422477
2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 41422477) has the molecular formula C23H26ClN5OS and a molecular weight of 456.02 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 41422477 |
| Molecular Formula | C23H26ClN5OS |
| Molecular Weight | 456.02 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCCCN(C)c2ccccc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClN5OS/c1-3-15-29-22(18-10-12-19(24)13-11-18)26-27-23(29)31-17-21(30)25-14-7-16-28(2)20-8-5-4-6-9-20/h3-6,8-13H,1,7,14-17H2,2H3,(H,25,30) |
| InChIKey | OMTJCULCAKFIAW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.02 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|