C24H24ClN5O2S — CID 16597138
6-amino-1-benzyl-5-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethylamino]pyrimidine-2,4-dione (PubChem CID 16597138) has the molecular formula C24H24ClN5O2S and a molecular weight of 482.01 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethylamino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethylamino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16597138 |
| Molecular Formula | C24H24ClN5O2S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 6-amino-1-benzyl-5-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethylamino]pyrimidine-2,4-dione |
| SMILES | CCN(Cc1cc2ccc(SC)cc2nc1Cl)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H24ClN5O2S/c1-3-29(14-17-11-16-9-10-18(33-2)12-19(16)27-21(17)25)20-22(26)30(24(32)28-23(20)31)13-15-7-5-4-6-8-15/h4-12H,3,13-14,26H2,1-2H3,(H,28,31,32) |
| InChIKey | ZCHGMLNXRZSFEX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|