C25H34N4O4S — CID 16599312
4-[[4-(azepan-1-ylsulfonyl)piperazin-1-yl]methyl]-N-(4-methoxyphenyl)benzamide (PubChem CID 16599312) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is 4-[[4-(azepan-1-ylsulfonyl)piperazin-1-yl]methyl]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 4-[[4-(azepan-1-ylsulfonyl)piperazin-1-yl]methyl]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 16599312 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 4-[[4-(azepan-1-ylsulfonyl)piperazin-1-yl]methyl]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(CN3CCN(S(=O)(=O)N4CCCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H34N4O4S/c1-33-24-12-10-23(11-13-24)26-25(30)22-8-6-21(7-9-22)20-27-16-18-29(19-17-27)34(31,32)28-14-4-2-3-5-15-28/h6-13H,2-5,14-20H2,1H3,(H,26,30) |
| InChIKey | VSBNSEPWIYLGAH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |