C8H6F3NO4 — CID 166000301
2-(furan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 166000301) has the molecular formula C8H6F3NO4 and a molecular weight of 237.13 g/mol. Its IUPAC name is 2-(furan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-(furan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 166000301 |
| Molecular Formula | C8H6F3NO4 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-(furan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | O=C(O)C(NC(=O)C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C8H6F3NO4/c9-8(10,11)7(15)12-5(6(13)14)4-2-1-3-16-4/h1-3,5H,(H,12,15)(H,13,14) |
| InChIKey | YTRITJCZKBFHDY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |