C7H10O3 — CID 166000570
4-methyl-5,6-dihydro-2H-pyran-3-carboxylic acid (PubChem CID 166000570) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 4-methyl-3,6-dihydro-2H-pyran-5-carboxylic acid.
| Compound Name | 4-methyl-5,6-dihydro-2H-pyran-3-carboxylic acid |
|---|---|
| PubChem CID | 166000570 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4-methyl-3,6-dihydro-2H-pyran-5-carboxylic acid |
| SMILES | CC1=C(COCC1)C(=O)O |
| InChI | InChI=1S/C7H10O3/c1-5-2-3-10-4-6(5)7(8)9/h2-4H2,1H3,(H,8,9) |
| InChIKey | TYKIUSMKPCGAPY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 181 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |