C54H46N18O10P+ — CID 166001950
tris[[4-[4-(3-acetyl-4-aminophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methoxy]-hydroxyphosphanium (PubChem CID 166001950) has the molecular formula C54H46N18O10P+ and a molecular weight of 1138.05 g/mol. Its IUPAC name is tris[[4-[4-(3-acetyl-4-aminophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methoxy]-hydroxyphosphanium.
| Compound Name | tris[[4-[4-(3-acetyl-4-aminophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methoxy]-hydroxyphosphanium |
|---|---|
| PubChem CID | 166001950 |
| Molecular Formula | C54H46N18O10P+ |
| Molecular Weight | 1138.05 g/mol |
| Exact Mass | 1137.34 |
| IUPAC Name | tris[[4-[4-(3-acetyl-4-aminophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methoxy]-hydroxyphosphanium |
| SMILES | CC(=O)c1cc(-c2ncc(-c3cnn(CO[P+](O)(OCn4cc(-c5cnc(-c6ccc(N)c(C(C)=O)c6)c6c(N)noc56)cn4)OCn4cc(-c5cnc(-c6ccc(N)c(C(C)=O)c6)c6c(N)noc56)cn4)c3)c3onc(N)c23)ccc1N |
| InChI | InChI=1S/C54H45N18O10P/c1-25(73)34-10-28(4-7-40(34)55)46-43-49(80-67-52(43)58)37(16-61-46)31-13-64-70(19-31)22-77-83(76,78-23-71-20-32(14-65-71)38-17-62-47(44-50(38)81-68-53(44)59)29-5-8-41(56)35(11-29)26(2)74)79-24-72-21-33(15-66-72)39-18-63-48(45-51(39)82-69-54(45)60)30-6-9-42(57)36(12-30)27(3)75/h4-21,76H,22-24H2,1-3H3,(H11-,55,56,57,58,59,60,61,62,63,67,68,69,73,74,75)/p+1 |
| InChIKey | CBBKYBSVMQNTNZ-UHFFFAOYSA-O |
| XLogP | 7.98 |
| TPSA | 425.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 83 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.05 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|