C24H22F3NO2 — CID 166004205
[5-phenyl-2-[(3S)-3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]phenyl]methanol (PubChem CID 166004205) has the molecular formula C24H22F3NO2 and a molecular weight of 413.44 g/mol. Its IUPAC name is [5-phenyl-2-[(3S)-3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]phenyl]methanol.
| Compound Name | [5-phenyl-2-[(3S)-3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 166004205 |
| Molecular Formula | C24H22F3NO2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [5-phenyl-2-[(3S)-3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]phenyl]methanol |
| SMILES | OCc1cc(-c2ccccc2)ccc1N1CC[C@H](Oc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H22F3NO2/c25-24(26,27)20-7-9-21(10-8-20)30-22-12-13-28(15-22)23-11-6-18(14-19(23)16-29)17-4-2-1-3-5-17/h1-11,14,22,29H,12-13,15-16H2/t22-/m0/s1 |
| InChIKey | POPKWWXTQMALBV-QFIPXVFZSA-N |
| XLogP | 5.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |