About N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine
N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine (PubChem CID 166004673) has the molecular formula C19H39NO3
and a molecular weight of 329.52 g/mol. Its IUPAC name is N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine |
| PubChem CID | 166004673 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.52 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine |
| SMILES | CC(C)(C)COCCOC1CC(OCCCCNC(C)(C)C)C1 |
| InChI | InChI=1S/C19H39NO3/c1-18(2,3)15-21-11-12-23-17-13-16(14-17)22-10-8-7-9-20-19(4,5)6/h16-17,20H,7-15H2,1-6H3 |
| InChIKey | PYFHRTUZRLKPOO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine?
The IUPAC name of N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine (CID 166004673) is N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine.
What is the SMILES notation for N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine?
The canonical SMILES for N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine is CC(C)(C)COCCOC1CC(OCCCCNC(C)(C)C)C1.
What is the InChIKey of N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine?
The InChIKey is PYFHRTUZRLKPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO3/c1-18(2,3)15-21-11-12-23-17-13-16(14-17)22-10-8-7-9-20-19(4,5)6/h16-17,20H,7-15H2,1-6H3.
What are the key properties of N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine?
N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine has a molecular weight of 329.52 g/mol, XLogP of 3.78, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4-[3-[2-(2,2-dimethylpropoxy)ethoxy]cyclobutyl]oxybutan-1-amine is sourced from PubChem (CID 166004673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).