C14H18N2O4 — CID 166005196
propyl 3-amino-2-benzamido-2-methyl-3-oxopropanoate (PubChem CID 166005196) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is propyl 3-amino-2-benzamido-2-methyl-3-oxopropanoate.
| Compound Name | propyl 3-amino-2-benzamido-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 166005196 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | propyl 3-amino-2-benzamido-2-methyl-3-oxopropanoate |
| SMILES | CCCOC(=O)C(C)(NC(=O)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C14H18N2O4/c1-3-9-20-13(19)14(2,12(15)18)16-11(17)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | ZJLPQLNOSNXHGQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|