C16H22IN3O2 — CID 166009645
4-[2-[2-(3-iodopyrazolo[1,5-a]pyridin-6-yl)propan-2-yloxy]ethyl]morpholine (PubChem CID 166009645) has the molecular formula C16H22IN3O2 and a molecular weight of 415.28 g/mol. Its IUPAC name is 4-[2-[2-(3-iodopyrazolo[1,5-a]pyridin-6-yl)propan-2-yloxy]ethyl]morpholine.
| Compound Name | 4-[2-[2-(3-iodopyrazolo[1,5-a]pyridin-6-yl)propan-2-yloxy]ethyl]morpholine |
|---|---|
| PubChem CID | 166009645 |
| Molecular Formula | C16H22IN3O2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 4-[2-[2-(3-iodopyrazolo[1,5-a]pyridin-6-yl)propan-2-yloxy]ethyl]morpholine |
| SMILES | CC(C)(OCCN1CCOCC1)c1ccc2c(I)cnn2c1 |
| InChI | InChI=1S/C16H22IN3O2/c1-16(2,22-10-7-19-5-8-21-9-6-19)13-3-4-15-14(17)11-18-20(15)12-13/h3-4,11-12H,5-10H2,1-2H3 |
| InChIKey | WXDKPMVRAZZZQH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|