C29H18N3O3PRb+ — CID 166012299
6-[1,10-phenanthrolin-2-yl(phenyl)phosphoryl]-[1]benzofuro[3,2-b]pyridin-1-ium-9-olate;rubidium(1+) (PubChem CID 166012299) has the molecular formula C29H18N3O3PRb+ and a molecular weight of 572.92 g/mol. Its IUPAC name is 6-[1,10-phenanthrolin-2-yl(phenyl)phosphoryl]-[1]benzofuro[3,2-b]pyridin-1-ium-9-olate;rubidium(1+).
| Compound Name | 6-[1,10-phenanthrolin-2-yl(phenyl)phosphoryl]-[1]benzofuro[3,2-b]pyridin-1-ium-9-olate;rubidium(1+) |
|---|---|
| PubChem CID | 166012299 |
| Molecular Formula | C29H18N3O3PRb+ |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | 6-[1,10-phenanthrolin-2-yl(phenyl)phosphoryl]-[1]benzofuro[3,2-b]pyridin-1-ium-9-olate;rubidium(1+) |
| SMILES | O=P(c1ccccc1)(c1ccc2ccc3cccnc3c2n1)c1ccc([O-])c2c1oc1ccc[nH+]c12.[Rb+] |
| InChI | InChI=1S/C29H18N3O3P.Rb/c33-21-13-14-23(29-25(21)28-22(35-29)9-5-17-31-28)36(34,20-7-2-1-3-8-20)24-15-12-19-11-10-18-6-4-16-30-26(18)27(19)32-24;/h1-17,33H;/q;+1 |
| InChIKey | NYMVAALJSNSNHC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|