C25H24N4O3S — CID 16601465
4-(3,4-dimethoxyphenyl)-1-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide (PubChem CID 16601465) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-1-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 16601465 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-1-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(-c2cn(-c3ccccc3)nc2C(=O)Nc2nc3c(s2)CCCC3)cc1OC |
| InChI | InChI=1S/C25H24N4O3S/c1-31-20-13-12-16(14-21(20)32-2)18-15-29(17-8-4-3-5-9-17)28-23(18)24(30)27-25-26-19-10-6-7-11-22(19)33-25/h3-5,8-9,12-15H,6-7,10-11H2,1-2H3,(H,26,27,30) |
| InChIKey | ZOHLAONUPMNNLH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |