C19H16N2O5S2 — CID 16601710
N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-3-methylfuran-2-carboxamide (PubChem CID 16601710) has the molecular formula C19H16N2O5S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 16601710 |
| Molecular Formula | C19H16N2O5S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCCN1C(=O)/C(=C\c2ccc3c(c2)OCO3)SC1=S |
| InChI | InChI=1S/C19H16N2O5S2/c1-11-4-7-24-16(11)17(22)20-5-6-21-18(23)15(28-19(21)27)9-12-2-3-13-14(8-12)26-10-25-13/h2-4,7-9H,5-6,10H2,1H3,(H,20,22)/b15-9+ |
| InChIKey | WVACUJFDGNABHK-OQLLNIDSSA-N |
| XLogP | 2.95 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|