C43H35N3O — CID 166017775
2-phenyl-4-(4-phenylphenyl)-6-spiro[adamantane-2,9'-xanthene]-2'-yl-1,3,5-triazine (PubChem CID 166017775) has the molecular formula C43H35N3O and a molecular weight of 609.77 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-spiro[adamantane-2,9'-xanthene]-2'-yl-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-spiro[adamantane-2,9'-xanthene]-2'-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 166017775 |
| Molecular Formula | C43H35N3O |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-spiro[adamantane-2,9'-xanthene]-2'-yl-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)C4(c6ccccc6O5)C5CC6CC(C5)CC4C6)n3)cc2)cc1 |
| InChI | InChI=1S/C43H35N3O/c1-3-9-29(10-4-1)30-15-17-32(18-16-30)41-44-40(31-11-5-2-6-12-31)45-42(46-41)33-19-20-39-37(26-33)43(36-13-7-8-14-38(36)47-39)34-22-27-21-28(24-34)25-35(43)23-27/h1-20,26-28,34-35H,21-25H2 |
| InChIKey | VMKYJBJKLVJANO-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |