C34H36BN3 — CID 166020268
5-(4-tert-butylnaphthalen-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-g]isoquinoline (PubChem CID 166020268) has the molecular formula C34H36BN3 and a molecular weight of 497.50 g/mol. Its IUPAC name is 5-(4-tert-butylnaphthalen-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-g]isoquinoline.
| Compound Name | 5-(4-tert-butylnaphthalen-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 166020268 |
| Molecular Formula | C34H36BN3 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 5-(4-tert-butylnaphthalen-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-g]isoquinoline |
| SMILES | Cc1cc(C)c(B2N(C)c3cc4ccnc(-c5cc(C(C)(C)C)c6ccccc6c5)c4cc3N2C)c(C)c1 |
| InChI | InChI=1S/C34H36BN3/c1-21-15-22(2)32(23(3)16-21)35-37(7)30-19-25-13-14-36-33(28(25)20-31(30)38(35)8)26-17-24-11-9-10-12-27(24)29(18-26)34(4,5)6/h9-20H,1-8H3 |
| InChIKey | XZAXFVJLVAFTLE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|