C24H23BrN4O3S — CID 166020634
methyl 2-[[(2R,5S)-5-(6-bromo-2-pyridinyl)oxan-2-yl]methyl]-3-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate (PubChem CID 166020634) has the molecular formula C24H23BrN4O3S and a molecular weight of 527.44 g/mol. Its IUPAC name is methyl 2-[[(2R,5S)-5-(6-bromo-2-pyridinyl)oxan-2-yl]methyl]-3-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[[(2R,5S)-5-(6-bromo-2-pyridinyl)oxan-2-yl]methyl]-3-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 166020634 |
| Molecular Formula | C24H23BrN4O3S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | methyl 2-[[(2R,5S)-5-(6-bromo-2-pyridinyl)oxan-2-yl]methyl]-3-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(C[C@H]3CC[C@@H](c4cccc(Br)n4)CO3)n(Cc3cncs3)c2c1 |
| InChI | InChI=1S/C24H23BrN4O3S/c1-31-24(30)15-6-8-20-21(9-15)29(12-18-11-26-14-33-18)23(28-20)10-17-7-5-16(13-32-17)19-3-2-4-22(25)27-19/h2-4,6,8-9,11,14,16-17H,5,7,10,12-13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | KYKDEZFLJHSCBY-IAGOWNOFSA-N |
| XLogP | 4.99 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|