C28H28ClFN4O7 — CID 166021427
4-O-[(Z)-[amino-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]methylidene]amino] 1-O-benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 166021427) has the molecular formula C28H28ClFN4O7 and a molecular weight of 587.00 g/mol. Its IUPAC name is 4-O-[(Z)-[amino-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]methylidene]amino] 1-O-benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 4-O-[(Z)-[amino-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]methylidene]amino] 1-O-benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 166021427 |
| Molecular Formula | C28H28ClFN4O7 |
| Molecular Weight | 587.00 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 4-O-[(Z)-[amino-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]methylidene]amino] 1-O-benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O/N=C(\N)c1ccc(Oc2ncc(Cl)cc2F)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H28ClFN4O7/c1-28(2,3)40-27(37)33-22(26(36)38-16-17-7-5-4-6-8-17)14-23(35)41-34-24(31)18-9-11-20(12-10-18)39-25-21(30)13-19(29)15-32-25/h4-13,15,22H,14,16H2,1-3H3,(H2,31,34)(H,33,37)/t22-/m1/s1 |
| InChIKey | PVFNEGOPQIOPFR-JOCHJYFZSA-N |
| XLogP | 4.86 |
| TPSA | 151.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|