C30H39N6O3S+ — CID 166022537
N-[6-amino-5-(oxolan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,2-benzothiazol-2-ium-5-yl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 166022537) has the molecular formula C30H39N6O3S+ and a molecular weight of 563.75 g/mol. Its IUPAC name is N-[6-amino-5-(oxolan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,2-benzothiazol-2-ium-5-yl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[6-amino-5-(oxolan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,2-benzothiazol-2-ium-5-yl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 166022537 |
| Molecular Formula | C30H39N6O3S+ |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[6-amino-5-(oxolan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,2-benzothiazol-2-ium-5-yl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@H]1CC[C@H](c2ccc3s[n+](C4CCN(C)CC4)cc3c2)N(C(=O)C(=O)Nc2cnc(N)c(C3CCOC3)c2)C1 |
| InChI | InChI=1S/C30H38N6O3S/c1-19-3-5-26(20-4-6-27-22(13-20)17-36(40-27)24-7-10-34(2)11-8-24)35(16-19)30(38)29(37)33-23-14-25(28(31)32-15-23)21-9-12-39-18-21/h4,6,13-15,17,19,21,24,26H,3,5,7-12,16,18H2,1-2H3,(H2-,31,32,33,37,38)/p+1/t19-,21?,26+/m0/s1 |
| InChIKey | XYYNDUGBPYCLBN-JBJIOCITSA-O |
| XLogP | 3.87 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|