C20H30N4O4 — CID 166022561
tert-butyl N-[5-[[2-[(2S,5R)-2,5-dimethylpiperidin-2-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate (PubChem CID 166022561) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-[(2S,5R)-2,5-dimethylpiperidin-2-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-[(2S,5R)-2,5-dimethylpiperidin-2-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 166022561 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | tert-butyl N-[5-[[2-[(2S,5R)-2,5-dimethylpiperidin-2-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
| SMILES | Cc1cc(NC(=O)C(=O)[C@]2(C)CC[C@@H](C)CN2)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30N4O4/c1-12-7-8-20(6,22-10-12)15(25)17(26)23-14-9-13(2)16(21-11-14)24-18(27)28-19(3,4)5/h9,11-12,22H,7-8,10H2,1-6H3,(H,23,26)(H,21,24,27)/t12-,20+/m1/s1 |
| InChIKey | PJNFRNDTRVSLPW-ODXCJYRJSA-N |
| XLogP | 3.02 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|