C24H30N4O4 — CID 167033491
tert-butyl N-[3-methyl-5-[[2-oxo-2-[(2R)-2-phenylpiperidin-1-yl]acetyl]amino]-2-pyridinyl]carbamate (PubChem CID 167033491) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-5-[[2-oxo-2-[(2R)-2-phenylpiperidin-1-yl]acetyl]amino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-5-[[2-oxo-2-[(2R)-2-phenylpiperidin-1-yl]acetyl]amino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 167033491 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | tert-butyl N-[3-methyl-5-[[2-oxo-2-[(2R)-2-phenylpiperidin-1-yl]acetyl]amino]-2-pyridinyl]carbamate |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCCC[C@@H]2c2ccccc2)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30N4O4/c1-16-14-18(15-25-20(16)27-23(31)32-24(2,3)4)26-21(29)22(30)28-13-9-8-12-19(28)17-10-6-5-7-11-17/h5-7,10-11,14-15,19H,8-9,12-13H2,1-4H3,(H,26,29)(H,25,27,31)/t19-/m1/s1 |
| InChIKey | YMYPRBCVTXUGFB-LJQANCHMSA-N |
| XLogP | 4.43 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|