C26H30N4O4S — CID 164751478
tert-butyl N-[5-[[2-[2-(1-benzothiophen-3-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate (PubChem CID 164751478) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-[2-(1-benzothiophen-3-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-[2-(1-benzothiophen-3-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164751478 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | tert-butyl N-[5-[[2-[2-(1-benzothiophen-3-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCCCC2c2csc3ccccc23)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H30N4O4S/c1-16-13-17(14-27-22(16)29-25(33)34-26(2,3)4)28-23(31)24(32)30-12-8-7-10-20(30)19-15-35-21-11-6-5-9-18(19)21/h5-6,9,11,13-15,20H,7-8,10,12H2,1-4H3,(H,28,31)(H,27,29,33) |
| InChIKey | NZKADIMNMXMHRR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|