C22H28N4O4S — CID 164753900
tert-butyl N-[3-methyl-5-[[2-oxo-2-(2-thiophen-2-ylpiperidin-1-yl)acetyl]amino]-2-pyridinyl]carbamate (PubChem CID 164753900) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-5-[[2-oxo-2-(2-thiophen-2-ylpiperidin-1-yl)acetyl]amino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-5-[[2-oxo-2-(2-thiophen-2-ylpiperidin-1-yl)acetyl]amino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164753900 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | tert-butyl N-[3-methyl-5-[[2-oxo-2-(2-thiophen-2-ylpiperidin-1-yl)acetyl]amino]-2-pyridinyl]carbamate |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCCCC2c2cccs2)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28N4O4S/c1-14-12-15(13-23-18(14)25-21(29)30-22(2,3)4)24-19(27)20(28)26-10-6-5-8-16(26)17-9-7-11-31-17/h7,9,11-13,16H,5-6,8,10H2,1-4H3,(H,24,27)(H,23,25,29) |
| InChIKey | YAPMRRJYTTYISF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|