C19H24N4O2S — CID 175636967
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,6R)-6-methyl-2-thiophen-2-ylazepan-1-yl]-2-oxoacetamide (PubChem CID 175636967) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,6R)-6-methyl-2-thiophen-2-ylazepan-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,6R)-6-methyl-2-thiophen-2-ylazepan-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 175636967 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,6R)-6-methyl-2-thiophen-2-ylazepan-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@H](C)CCC[C@H]2c2cccs2)cnc1N |
| InChI | InChI=1S/C19H24N4O2S/c1-12-5-3-6-15(16-7-4-8-26-16)23(11-12)19(25)18(24)22-14-9-13(2)17(20)21-10-14/h4,7-10,12,15H,3,5-6,11H2,1-2H3,(H2,20,21)(H,22,24)/t12-,15+/m1/s1 |
| InChIKey | ABTGXWQZXGFCPK-DOMZBBRYSA-N |
| XLogP | 3.36 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|