C19H22N4O2S — CID 164750467
N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetamide (PubChem CID 164750467) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 164750467 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@H]3CC[C@H](C3)[C@H]2c2cccs2)cnc1N |
| InChI | InChI=1S/C19H22N4O2S/c1-11-7-14(9-21-17(11)20)22-18(24)19(25)23-10-12-4-5-13(8-12)16(23)15-3-2-6-26-15/h2-3,6-7,9,12-13,16H,4-5,8,10H2,1H3,(H2,20,21)(H,22,24)/t12-,13+,16-/m0/s1 |
| InChIKey | CWPVLWLMJCNXSS-ZENOOKHLSA-N |
| XLogP | 2.97 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|