C19H20N4O3S — CID 164753423
5-[[2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetyl]amino]pyridine-3-carboxamide (PubChem CID 164753423) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 5-[[2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164753423 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 5-[[2-oxo-2-[(1R,2S,5S)-2-thiophen-2-yl-3-azabicyclo[3.2.1]octan-3-yl]acetyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(NC(=O)C(=O)N2C[C@H]3CC[C@H](C3)[C@H]2c2cccs2)c1 |
| InChI | InChI=1S/C19H20N4O3S/c20-17(24)13-7-14(9-21-8-13)22-18(25)19(26)23-10-11-3-4-12(6-11)16(23)15-2-1-5-27-15/h1-2,5,7-9,11-12,16H,3-4,6,10H2,(H2,20,24)(H,22,25)/t11-,12+,16-/m0/s1 |
| InChIKey | BRHFOLWRLGVRCD-OZVIIMIRSA-N |
| XLogP | 2.18 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|