C19H22N4O3S — CID 175632574
5-[[2-[(5S)-5-methyl-2-(thiophen-2-ylmethyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 175632574) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 5-[[2-[(5S)-5-methyl-2-(thiophen-2-ylmethyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[(5S)-5-methyl-2-(thiophen-2-ylmethyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175632574 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-[[2-[(5S)-5-methyl-2-(thiophen-2-ylmethyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | C[C@H]1CCC(Cc2cccs2)N(C(=O)C(=O)Nc2cncc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C19H22N4O3S/c1-12-4-5-15(8-16-3-2-6-27-16)23(11-12)19(26)18(25)22-14-7-13(17(20)24)9-21-10-14/h2-3,6-7,9-10,12,15H,4-5,8,11H2,1H3,(H2,20,24)(H,22,25)/t12-,15?/m0/s1 |
| InChIKey | AXKQOXGAKVTKSD-SFVWDYPZSA-N |
| XLogP | 2.05 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|