C19H21F2N5O2 — CID 171600987
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,3S,5R)-3-fluoro-2-(6-fluoro-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 171600987) has the molecular formula C19H21F2N5O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,3S,5R)-3-fluoro-2-(6-fluoro-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,3S,5R)-3-fluoro-2-(6-fluoro-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 171600987 |
| Molecular Formula | C19H21F2N5O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,3S,5R)-3-fluoro-2-(6-fluoro-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@H](C)C[C@H](F)[C@H]2c2ccc(F)nc2)cnc1N |
| InChI | InChI=1S/C19H21F2N5O2/c1-10-5-14(20)16(12-3-4-15(21)23-7-12)26(9-10)19(28)18(27)25-13-6-11(2)17(22)24-8-13/h3-4,6-8,10,14,16H,5,9H2,1-2H3,(H2,22,24)(H,25,27)/t10-,14+,16-/m1/s1 |
| InChIKey | DZCSURRXOHOAHC-FUEDEBDSSA-N |
| XLogP | 2.39 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|