C21H26N4O2 — CID 164751690
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,3S,5R)-3,5-dimethyl-2-phenylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 164751690) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,3S,5R)-3,5-dimethyl-2-phenylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,3S,5R)-3,5-dimethyl-2-phenylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164751690 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,3S,5R)-3,5-dimethyl-2-phenylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@H](C)C[C@H](C)[C@H]2c2ccccc2)cnc1N |
| InChI | InChI=1S/C21H26N4O2/c1-13-9-14(2)18(16-7-5-4-6-8-16)25(12-13)21(27)20(26)24-17-10-15(3)19(22)23-11-17/h4-8,10-11,13-14,18H,9,12H2,1-3H3,(H2,22,23)(H,24,26)/t13-,14+,18+/m1/s1 |
| InChIKey | XBDGAJBBMHCQRC-GLJUWKHASA-N |
| XLogP | 3.16 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|