C22H27N3O2 — CID 171755975
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,4R,5R)-4,5-dimethyl-2-phenylcyclohexyl]-2-oxoacetamide (PubChem CID 171755975) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,4R,5R)-4,5-dimethyl-2-phenylcyclohexyl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,4R,5R)-4,5-dimethyl-2-phenylcyclohexyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 171755975 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,4R,5R)-4,5-dimethyl-2-phenylcyclohexyl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)C2C[C@@H](C)[C@H](C)C[C@@H]2c2ccccc2)cnc1N |
| InChI | InChI=1S/C22H27N3O2/c1-13-10-18(16-7-5-4-6-8-16)19(11-14(13)2)20(26)22(27)25-17-9-15(3)21(23)24-12-17/h4-9,12-14,18-19H,10-11H2,1-3H3,(H2,23,24)(H,25,27)/t13-,14-,18-,19?/m1/s1 |
| InChIKey | RJTZHSQVQKFEFG-TVGWAPAASA-N |
| XLogP | 3.95 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|