C20H18Cl2N2O3S — CID 166023428
[5-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]-2-hydroxyphenyl] formate (PubChem CID 166023428) has the molecular formula C20H18Cl2N2O3S and a molecular weight of 437.35 g/mol. Its IUPAC name is [5-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]-2-hydroxyphenyl] formate.
| Compound Name | [5-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]-2-hydroxyphenyl] formate |
|---|---|
| PubChem CID | 166023428 |
| Molecular Formula | C20H18Cl2N2O3S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | [5-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]-2-hydroxyphenyl] formate |
| SMILES | CC(C)Cc1sc(Nc2ccc(O)c(OC=O)c2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N2O3S/c1-11(2)7-18-19(12-3-5-14(21)15(22)8-12)24-20(28-18)23-13-4-6-16(26)17(9-13)27-10-25/h3-6,8-11,26H,7H2,1-2H3,(H,23,24) |
| InChIKey | WDCVZSMMOBGEPM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|