C19H20Cl2N4O2 — CID 166026442
3-amino-2-[4-(hydroxymethyl)phenyl]-N-[4-(1H-pyrazol-4-yl)phenyl]prop-2-enamide;dihydrochloride (PubChem CID 166026442) has the molecular formula C19H20Cl2N4O2 and a molecular weight of 407.30 g/mol. Its IUPAC name is 3-amino-2-[4-(hydroxymethyl)phenyl]-N-[4-(1H-pyrazol-4-yl)phenyl]prop-2-enamide;dihydrochloride.
| Compound Name | 3-amino-2-[4-(hydroxymethyl)phenyl]-N-[4-(1H-pyrazol-4-yl)phenyl]prop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 166026442 |
| Molecular Formula | C19H20Cl2N4O2 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-amino-2-[4-(hydroxymethyl)phenyl]-N-[4-(1H-pyrazol-4-yl)phenyl]prop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.NC=C(C(=O)Nc1ccc(-c2cn[nH]c2)cc1)c1ccc(CO)cc1 |
| InChI | InChI=1S/C19H18N4O2.2ClH/c20-9-18(15-3-1-13(12-24)2-4-15)19(25)23-17-7-5-14(6-8-17)16-10-21-22-11-16;;/h1-11,24H,12,20H2,(H,21,22)(H,23,25);2*1H |
| InChIKey | YULUEYULMFICCN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|