C38H54IrNO2- — CID 166026596
4-butan-2-yl-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-7-hydroxy-2,4,4,8,8,10-hexamethylundec-6-en-5-one;iridium (PubChem CID 166026596) has the molecular formula C38H54IrNO2- and a molecular weight of 749.07 g/mol. Its IUPAC name is 4-butan-2-yl-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-7-hydroxy-2,4,4,8,8,10-hexamethylundec-6-en-5-one;iridium.
| Compound Name | 4-butan-2-yl-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-7-hydroxy-2,4,4,8,8,10-hexamethylundec-6-en-5-one;iridium |
|---|---|
| PubChem CID | 166026596 |
| Molecular Formula | C38H54IrNO2- |
| Molecular Weight | 749.07 g/mol |
| Exact Mass | 749.38 |
| IUPAC Name | 4-butan-2-yl-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-7-hydroxy-2,4,4,8,8,10-hexamethylundec-6-en-5-one;iridium |
| SMILES | CC(C)CC(C)(C)C(=O)/C=C(\O)C(C)(C)CC(C)C.CCC(C)c1cc(-c2[c-]c(C)cc(C)c2)nc2ccccc12.[Ir] |
| InChI | InChI=1S/C21H22N.C17H32O2.Ir/c1-5-16(4)19-13-21(17-11-14(2)10-15(3)12-17)22-20-9-7-6-8-18(19)20;1-12(2)10-16(5,6)14(18)9-15(19)17(7,8)11-13(3)4;/h6-11,13,16H,5H2,1-4H3;9,12-13,18H,10-11H2,1-8H3;/q-1;;/b;14-9-; |
| InChIKey | NXHKULJJNYEAQO-XQKBYGRFSA-N |
| XLogP | 10.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.07 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|