C22H17ClF3N3O2 — CID 166031165
2-chloro-N-[5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]quinoline-4-carboxamide (PubChem CID 166031165) has the molecular formula C22H17ClF3N3O2 and a molecular weight of 447.84 g/mol. Its IUPAC name is 2-chloro-N-[5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]quinoline-4-carboxamide.
| Compound Name | 2-chloro-N-[5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 166031165 |
| Molecular Formula | C22H17ClF3N3O2 |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 2-chloro-N-[5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]quinoline-4-carboxamide |
| SMILES | O=C(NC1CC(=O)N(Cc2ccccc2C(F)(F)F)C1)c1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C22H17ClF3N3O2/c23-19-10-16(15-6-2-4-8-18(15)28-19)21(31)27-14-9-20(30)29(12-14)11-13-5-1-3-7-17(13)22(24,25)26/h1-8,10,14H,9,11-12H2,(H,27,31) |
| InChIKey | QAKLRUKIJCMGDQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|