C25H28N2O4S — CID 16603174
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate (PubChem CID 16603174) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 16603174 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate |
| SMILES | COc1ccc2c(c1)c(C(=O)OCC(=O)NCCSc1ccc(C)cc1)c(C)n2C1CC1 |
| InChI | InChI=1S/C25H28N2O4S/c1-16-4-9-20(10-5-16)32-13-12-26-23(28)15-31-25(29)24-17(2)27(18-6-7-18)22-11-8-19(30-3)14-21(22)24/h4-5,8-11,14,18H,6-7,12-13,15H2,1-3H3,(H,26,28) |
| InChIKey | VFILCSBNLYFNIG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|