C18H21NO4 — CID 18281159
3-oxobutan-2-yl 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate (PubChem CID 18281159) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-oxobutan-2-yl 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate.
| Compound Name | 3-oxobutan-2-yl 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 18281159 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-oxobutan-2-yl 1-cyclopropyl-5-methoxy-2-methylindole-3-carboxylate |
| SMILES | COc1ccc2c(c1)c(C(=O)OC(C)C(C)=O)c(C)n2C1CC1 |
| InChI | InChI=1S/C18H21NO4/c1-10-17(18(21)23-12(3)11(2)20)15-9-14(22-4)7-8-16(15)19(10)13-5-6-13/h7-9,12-13H,5-6H2,1-4H3 |
| InChIKey | DHDHEBQINJPPGA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |