C17H20NO3- — CID 6954360
1-cyclohexyl-5-methoxy-2-methylindole-3-carboxylate (PubChem CID 6954360) has the molecular formula C17H20NO3- and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-cyclohexyl-5-methoxy-2-methylindole-3-carboxylate.
| Compound Name | 1-cyclohexyl-5-methoxy-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 6954360 |
| Molecular Formula | C17H20NO3- |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-cyclohexyl-5-methoxy-2-methylindole-3-carboxylate |
| SMILES | COc1ccc2c(c1)c(C(=O)[O-])c(C)n2C1CCCCC1 |
| InChI | InChI=1S/C17H21NO3/c1-11-16(17(19)20)14-10-13(21-2)8-9-15(14)18(11)12-6-4-3-5-7-12/h8-10,12H,3-7H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | BPMZOSFCQREIRL-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 54.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |