C25H38N4O2 — CID 112795503
1-cyclohexyl-5-methoxy-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]indole-3-carboxamide (PubChem CID 112795503) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-cyclohexyl-5-methoxy-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]indole-3-carboxamide.
| Compound Name | 1-cyclohexyl-5-methoxy-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 112795503 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 1-cyclohexyl-5-methoxy-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]indole-3-carboxamide |
| SMILES | COc1ccc2c(c1)c(C(=O)NCCCN1CCN(C)CC1)c(C)n2C1CCCCC1 |
| InChI | InChI=1S/C25H38N4O2/c1-19-24(25(30)26-12-7-13-28-16-14-27(2)15-17-28)22-18-21(31-3)10-11-23(22)29(19)20-8-5-4-6-9-20/h10-11,18,20H,4-9,12-17H2,1-3H3,(H,26,30) |
| InChIKey | OHQUOSJGRTXFNJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|