C26H31N3O4 — CID 112842247
N-[4-(3-amino-3-oxopropoxy)phenyl]-1-cyclohexyl-5-methoxy-2-methylindole-3-carboxamide (PubChem CID 112842247) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[4-(3-amino-3-oxopropoxy)phenyl]-1-cyclohexyl-5-methoxy-2-methylindole-3-carboxamide.
| Compound Name | N-[4-(3-amino-3-oxopropoxy)phenyl]-1-cyclohexyl-5-methoxy-2-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 112842247 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-[4-(3-amino-3-oxopropoxy)phenyl]-1-cyclohexyl-5-methoxy-2-methylindole-3-carboxamide |
| SMILES | COc1ccc2c(c1)c(C(=O)Nc1ccc(OCCC(N)=O)cc1)c(C)n2C1CCCCC1 |
| InChI | InChI=1S/C26H31N3O4/c1-17-25(26(31)28-18-8-10-20(11-9-18)33-15-14-24(27)30)22-16-21(32-2)12-13-23(22)29(17)19-6-4-3-5-7-19/h8-13,16,19H,3-7,14-15H2,1-2H3,(H2,27,30)(H,28,31) |
| InChIKey | BGENBLMDEQEPNP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |