C24H33N3O4 — CID 112815425
1-cyclohexyl-5-methoxy-2-methyl-N-(3-morpholin-4-yl-3-oxopropyl)indole-3-carboxamide (PubChem CID 112815425) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-cyclohexyl-5-methoxy-2-methyl-N-(3-morpholin-4-yl-3-oxopropyl)indole-3-carboxamide.
| Compound Name | 1-cyclohexyl-5-methoxy-2-methyl-N-(3-morpholin-4-yl-3-oxopropyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 112815425 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 1-cyclohexyl-5-methoxy-2-methyl-N-(3-morpholin-4-yl-3-oxopropyl)indole-3-carboxamide |
| SMILES | COc1ccc2c(c1)c(C(=O)NCCC(=O)N1CCOCC1)c(C)n2C1CCCCC1 |
| InChI | InChI=1S/C24H33N3O4/c1-17-23(24(29)25-11-10-22(28)26-12-14-31-15-13-26)20-16-19(30-2)8-9-21(20)27(17)18-6-4-3-5-7-18/h8-9,16,18H,3-7,10-15H2,1-2H3,(H,25,29) |
| InChIKey | IYVYBJCLSMQQPJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |